|
|
| | 2-Chloro-1,4-phenylenediamine sulfate Basic information |
| Product Name: | 2-Chloro-1,4-phenylenediamine sulfate | | Synonyms: | O-CHLORO-P-PHENYLENE DIAMINE SULFATE;1,4-Diamino-2-chlorobenzenesulfate;2-chloro-1,4-benzenediaminesulfate(1:1);4-benzenediamine,2-chloro-sulfate(1:1);2,5-DIAMINOCHLOROBENZENE SULFATE;2-CHLORO-P-PHENYLENEDIAMINE SULPHATE;2-CHLORO-1,4-DIAMINOBENZENE SULFATE;2-CHLORO-1,4-DIAMINOBENZENE SULPHATE | | CAS: | 61702-44-1 | | MF: | C6H9ClN2O4S | | MW: | 240.66 | | EINECS: | 262-915-3 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 61702-44-1.mol |  |
| | 2-Chloro-1,4-phenylenediamine sulfate Chemical Properties |
| Melting point | 251-253 °C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Sparingly), Water (Slightly) | | form | Solid | | color | Off-White to Pale Grey | | Water Solubility | <0.1 g/100 mL at 21 ºC | | BRN | 8441373 | | Stability: | Stable. Incompatible with oxidizing agents, acids. | | Cosmetics Ingredients Functions | HAIR DYEING | | Cosmetic Ingredient Review (CIR) | 2-Chloro-1,4-phenylenediamine sulfate (61702-44-1) | | InChI | 1S/C6H7ClN2.H2O4S/c7-5-3-4(8)1-2-6(5)9;1-5(2,3)4/h1-3H,8-9H2;(H2,1,2,3,4) | | InChIKey | GQFGHCRXPLROOF-UHFFFAOYSA-N | | SMILES | OS(O)(=O)=O.Nc1ccc(N)c(Cl)c1 | | CAS DataBase Reference | 61702-44-1(CAS DataBase Reference) | | EPA Substance Registry System | 2-Chloro-1,4-phenylenediamine sulfate (1:1) (61702-44-1) |
| Hazard Codes | Xn | | Risk Statements | 20/21-36/37/38-33 | | Safety Statements | 26-36/37/39-39-36-22 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | CZ1581000 | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29215119 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Chloro-1,4-phenylenediamine sulfate Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 2-Chloro-p-phenylenediamine monosulfate (2-Chloro-1,4-diaminobenzene monosulfate) may be used in chemical synthesis studies. | | Definition | ChEBI: An arylammonium sulfate salt obtained by combining 2-chloro-1,4-phenylenediamine with one molar equivalent of sulfuric acid. | | General Description | Light gray or lavender powder. | | Air & Water Reactions | Oxidizes on exposure to air, becoming purple and eventually black [Hawley]. Insoluble in water. | | Reactivity Profile | An acidic salt of an amine. | | Fire Hazard | Flash point data for 2-Chloro-1,4-phenylenediamine sulfate are not available; however, 2-Chloro-1,4-phenylenediamine sulfate is probably combustible. |
| | 2-Chloro-1,4-phenylenediamine sulfate Preparation Products And Raw materials |
|