|
|
| | 4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE Basic information |
| | 4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE Chemical Properties |
| Melting point | 316-318 °C(lit.) | | Boiling point | 344.0±11.0 °C(Predicted) | | density | 1.103±0.06 g/cm3 (20 ºC 760 Torr) | | solubility | chloroform: soluble2.5%, clear, colorless | | pka | 15.95±0.20(Predicted) | | InChI | 1S/C10H15NO/c12-10-8-2-6-1-7(3-8)5-9(4-6)11-10/h6-9H,1-5H2,(H,11,12)/t6-,7+,8-,9+ | | InChIKey | OKDJIRNQPPBDKJ-SPJNRGJMSA-N | | SMILES | O=C1N[C@H]2C[C@@H]3C[C@H](C2)C[C@H]1C3 | | CAS DataBase Reference | 22607-75-6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | CM0732000 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE Usage And Synthesis |
| Uses | 4-Azatricyclo[4.3.1.1]undecan-5-one is formed during the Beckman rearrangement of adamantanone oxime. Crystal structure of 4-azatricyclo[4.3.1.1]undecan-5-one (homoazaadamantanone) has been studied. | | General Description | 4-Azatricyclo[4.3.1.1]undecan-5-one is formed during the Beckman rearrangement of adamantanone oxime. Crystal structure of 4-azatricyclo[4.3.1.1]undecan-5-one (homoazaadamantanone) has been studied. |
| | 4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE Preparation Products And Raw materials |
| Preparation Products | 2,5,6,7,8,9,10,11-Octahydro-3H-5,9:7,11-dimethano-[1,2,4]triazolo[4,3-a]azonin-3-one |
|