| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(S)-(+)-6,6'-Dibromo-1,1'-bi-2-naphthol manufacturers
|
| | (S)-(+)-6,6'-Dibromo-1,1'-bi-2-naphthol Basic information | | Reactions |
| Product Name: | (S)-(+)-6,6'-Dibromo-1,1'-bi-2-naphthol | | Synonyms: | 6,6'-Dibromo-1,1'-binaphthalene-2,2'-diol;6,6'-Dibromo-2,2'-dihydroxy-1,1'-binaphthalene;6,6'-Dibromo-1,1'-bi-2-naphthol 97%;AURORA KA-7214;(+/-)-6,6'-DIBROMO-1,1'-BI-2-NAPHTHOL;6,6'-DIBROMO-1,1'-BI-2-NAPHTHOL;6,6'-Dibromo-1,1'-bi-2-naphthol (RAC);racemic-6,6'-Dibromo-1,1'-bi-2-naphthol,min.98% | | CAS: | 13185-00-7 | | MF: | C20H12Br2O2 | | MW: | 444.12 | | EINECS: | | | Product Categories: | BINOL Series;Achiral Oxygen;Organic Building Blocks;Oxygen Compounds;Polyols | | Mol File: | 13185-00-7.mol |  |
| | (S)-(+)-6,6'-Dibromo-1,1'-bi-2-naphthol Chemical Properties |
| Melting point | 195-199 °C(lit.) | | Boiling point | 546.2±45.0 °C(Predicted) | | density | 1.761 | | refractive index | 1.4947 (estimate) | | storage temp. | 2-8°C | | form | Powder | | pka | 7.78±0.50(Predicted) | | color | white | | Optical Rotation | -0.64°(C=1g/100ml CHCL3) | | InChI | 1S/C20H12Br2O2/c21-13-3-5-15-11(9-13)1-7-17(23)19(15)20-16-6-4-14(22)10-12(16)2-8-18(20)24/h1-10,23-24H | | InChIKey | OORIFUHRGQKYEV-UHFFFAOYSA-N | | SMILES | Oc1ccc2cc(Br)ccc2c1-c3c(O)ccc4cc(Br)ccc34 | | CAS DataBase Reference | 13185-00-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29072900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(+)-6,6'-Dibromo-1,1'-bi-2-naphthol Usage And Synthesis |
| Reactions | 1. Ligand (enantiopure version) used to prepare a chiral zirconium catalyst useful in asymmetric Strecker and Mannich-type reactions.
2. Ligand (enantiopure version) used for titanium-catalyzed enantioselective Friedel-Crafts reactions.
| | Chemical Properties | white powder | | Uses | 6,6′-Dibromo-1,1′-bi-2-naphthol is a 1,1′-bi-2-naphthol derivative. Vibrational circular dichroism (VCD), electronic circular dichroism (ECD) and optical rotatory dispersion (ORD) spectra for the enantiomers of 6,6′-dibromo-1,1′-bi-2-naphthol have been evaluated. | | General Description | 6,6′-Dibromo-1,1′-bi-2-naphthol is a 1,1′-bi-2-naphthol derivative. Vibrational circular dichroism (VCD), electronic circular dichroism (ECD) and optical rotatory dispersion (ORD) spectra for the enantiomers of 6,6′-dibromo-1,1′-bi-2-naphthol have been evaluated. |
| | (S)-(+)-6,6'-Dibromo-1,1'-bi-2-naphthol Preparation Products And Raw materials |
|