|
|
| | Triethyl 2-chloro-2-phosphonoacetate Basic information |
| | Triethyl 2-chloro-2-phosphonoacetate Chemical Properties |
| Boiling point | 93-95 °C0.01 mm Hg(lit.) | | density | 1.21 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.446(lit.) | | Fp | >230 °F | | storage temp. | Store at R.T. | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C8H16ClO5P/c1-4-12-8(10)7(9)15(11,13-5-2)14-6-3/h7H,4-6H2,1-3H3 | | InChIKey | PCDXCIMROXIFBI-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(Cl)P(=O)(OCC)OCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Triethyl 2-chloro-2-phosphonoacetate Usage And Synthesis |
| Uses | Triethyl 2-chloro-2-phosphonoacetate is a reagent that is used in the synthesis of isotope labelled Mutagen X (MX), which is a chlorinated furanone that accounts for more of the mutagenic activity of drinking water than any other disinfection byproduct. DNA damages provoked by the six mutagens (furylframide, MX, 4-nitroquinoline N-oxide, sodium azide, 1-nitropyrene, and captan) used in the present study have been known to subject to the nucleotide excision repair system. | | reaction suitability | reaction type: C-C Bond Formation |
| | Triethyl 2-chloro-2-phosphonoacetate Preparation Products And Raw materials |
|