|
|
| | 3-Acetyldeoxynivalenol Basic information |
| Product Name: | 3-Acetyldeoxynivalenol | | Synonyms: | 3-acetyldeoxynivalenol solution;3α-acetoxy-7α,15-dihydroxy-12,13-epoxytrichothec-9-en-8-one;3-ACETYL-DEOXYNIVALENOL SOLUTION (100Μ3α-Acetylvomitoxin, 3-AcDON, 3α-Acetoxy-7α,15-dihydroxy-12,13-epoxytrichothec-9-en-8-one;3α-Acetylvomitoxin, 3-AcDON, 3-ADON, 3α-Acetoxy-7α,15-dihydroxy-12,13-epoxytrichothec-9-en-8-one;12,13-Epoxy-3α-acetoxy-7α,15-dihydroxytrichothec-9-en-8-one;3α-Acetoxy-7α,15-dihydroxy-12,13-epoxytrichotheca-9-ene-8-one;DON-3-acetate | | CAS: | 50722-38-8 | | MF: | C17H22O7 | | MW: | 338.35 | | EINECS: | 621-771-5 | | Product Categories: | mycotoxin | | Mol File: | 50722-38-8.mol |  |
| | 3-Acetyldeoxynivalenol Chemical Properties |
| Melting point | 185.75°C | | Boiling point | 394.5°C (rough estimate) | | density | 1.2179 (rough estimate) | | refractive index | 1.4790 (estimate) | | Fp | 2 °C | | storage temp. | -20°C | | solubility | DMF: 30 mg/ml; DMSO: 25 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 10 mg/ml | | pka | 11.84±0.70(Predicted) | | form | powder | | biological source | Fusarium roseum | | Major Application | cleaning products cosmetics food and beverages personal care | | InChI | 1S/C17H22O7/c1-8-4-11-16(6-18,13(21)12(8)20)15(3)5-10(23-9(2)19)14(24-11)17(15)7-22-17/h4,10-11,13-14,18,21H,5-7H2,1-3H3/t10-,11-,13-,14-,15-,16-,17+/m1/s1 | | InChIKey | ADFIQZBYNGPCGY-HTJQZXIKSA-N | | SMILES | CC(=O)O[C@@H]1C[C@@]2(C)[C@]3(CO3)[C@@H]1O[C@@H]4C=C(C)C(=O)[C@@H](O)[C@]24CO | | LogP | -0.448 (est) |
| Hazard Codes | T,Xn,F | | Risk Statements | 23/24/25-36-20/21/22-11 | | Safety Statements | 36/37-45-26-16 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | YD0150000 | | HazardClass | 6.1(a) | | PackingGroup | I | | HS Code | 29329990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| | 3-Acetyldeoxynivalenol Usage And Synthesis |
| Chemical Properties | Solid | | Uses | 3-Acetyldeoxynivalenol is a trichothecene mycotoxin that is produced in a plant-pathogenic fungus, Fusarium graminearum Schwabe. | | Uses | 3-Acetyldeoxynivalenol solution may be used as an analytical reference standard for the quantification of the analyte in bovine milk using liquid chromatography coupled to tandem mass spectrometry (LC-MS/MS). | | Definition | ChEBI: 3-acetyldeoxynivalenol is a trichothecene mycotoxin that is deoxynivalenol acetylated on the oxygen at C-3. A skin and eye irritant, along with its 15-acetyl regioisomer and its parent deoxynivalenol it is considered among the most commonly and widely distributed cereal contaminants. It has a role as an epitope and a mycotoxin. It is functionally related to a deoxynivalenol. | | General Description | 3-Acetyldeoxynivalenol is a trichothecene mycotoxin, secreted by Fusarium species. It stimulates the activation of c-Jun N-terminal kinase (JNK)/ p38 mitogen-activated protein kinases and prevents protein synthesis. 3-Acetyldeoxynivalenol is a weak inducer of apoptosis. |
| | 3-Acetyldeoxynivalenol Preparation Products And Raw materials |
|