|
|
| | Dimethylvinphos Basic information |
| Product Name: | Dimethylvinphos | | Synonyms: | 2-chloro-1-(2,4-dichlorophenyl)ethenyldimethylphosphate;ent25,818;oms-712;phosphoricacid,2-chloro-1-(2,4-dichlorophenyl)ethenyldimethylester;phosphoricacid,2-chloro-1-(2,4-dichlorophenyl)vinyldimethylester;sd8280;(E)-DIMETHYLVINPHOS;DIMETHYLVINPHOS (E TYPE) | | CAS: | 2274-67-1 | | MF: | C10H10Cl3O4P | | MW: | 331.52 | | EINECS: | | | Product Categories: | | | Mol File: | 2274-67-1.mol |  |
| | Dimethylvinphos Chemical Properties |
| Melting point | 69.5 °C | | Boiling point | 126 °C(Press: 0.05 Torr) | | density | 1.448±0.06 g/cm3(Predicted) | | vapor pressure | 1.3 x 10-3 Pa (25 °C) | | storage temp. | -20°C | | Water Solubility | 130 mg l-1(20 °C) | | Henry's Law Constant | 3.0×102 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | InChI | 1S/C10H10Cl3O4P/c1-15-18(14,16-2)17-10(6-11)8-4-3-7(12)5-9(8)13/h3-6H,1-2H3/b10-6- | | InChIKey | QSGNQELHULIMSJ-POHAHGRESA-N | | SMILES | COP(=O)(OC)O\C(=C/Cl)c1ccc(Cl)cc1Cl |
| Hazard Codes | T,N | | Risk Statements | 25-50/53 | | Safety Statements | 45-60-61 | | RIDADR | 2783 | | WGK Germany | 3 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29199000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | Dimethylvinphos Usage And Synthesis |
| Uses | Dimethylvinphos is used to control stem borers and leaf rollers in
rice. | | Metabolic pathway | Dimethylvinphos is the dimethyl analogue of chlorf envinphos; however,
in contrast to that compound the technical material consists of >95% of
the Z-isomer. Dimethylvinphos is also a close chemical analogue of tetrachlorvinphos,
having a 2,4-dichloro substitution pattern rather than
2,4,5-trichloro on the phenylvinyl moiety and consequently the metabolism
of dimethylvinphos is qualitatively very similar to that of the other
two insecticides. In mammals, the principal route of metabolism of
dimethylvinphos is via oxidative and glutathione S-alkyltransferase
mediated demethylation to desmethyl dimethylvinphos which is hydrolysed
to 2,2',4'-trichloroacetophenone. This is further metabolised via a
series of glutathione mediated reactions to 1-(2,4-dichlorophenyl)ethanl-ol and 2,4-dichlorophenylethane-1,2-diol which are conjugated as the
glucuronides and excreted. 2,4-Dichlorophenylethane-1,2-diol may be
further metabolised by oxidation to 2,4-dichloromandelic which is
excreted or decarboxylated to 2,4-dichlorobenzoic acid. | | Degradation | Dimethylvinphos was hydrolysed in water at pH 7.0 with a half-life of
40 days at 25 °C. It was unstable in sunlight (PM). |
| | Dimethylvinphos Preparation Products And Raw materials |
|