4-CHLORO-6-FLUORO-2-METHYLQUINOLINE manufacturers
|
| | 4-CHLORO-6-FLUORO-2-METHYLQUINOLINE Basic information |
| | 4-CHLORO-6-FLUORO-2-METHYLQUINOLINE Chemical Properties |
| Boiling point | 269.9±35.0 °C(Predicted) | | density | 1.311±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.70±0.50(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C10H7ClFN/c1-6-4-9(11)8-5-7(12)2-3-10(8)13-6/h2-5H,1H3 | | InChIKey | GMMVVJJBQBYMNZ-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(F)=CC=2)C(Cl)=CC=1C | | CAS DataBase Reference | 18529-01-6(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 4-CHLORO-6-FLUORO-2-METHYLQUINOLINE Usage And Synthesis |
| Uses | 4-Chloro-6-fluoro-2-methylquinoline react with 2,6-Dinitro-4-trifluormethylnatriumphenolat, and obtain the 4-(2,6-dinitro-4-trifluoromethyl-phenoxy)-6-fluoro-2-methyl-quinoline. |
| | 4-CHLORO-6-FLUORO-2-METHYLQUINOLINE Preparation Products And Raw materials |
|