| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(R,R)-(+)-N,N′-Bis(α-Methylbenzyl)sulfaMide CAS:91410-68-3 Purity:99% Package:5G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(R,R)-(+)-N,N'-Bis(alpha-methylbenzyl)sulfamide CAS:91410-68-3 Purity:99% Package:5G Remarks:276081-5G
|
| Company Name: |
Shanghai Jiegu Biotechnology Co., Ltd.
|
| Tel: |
021-51698675 |
| Email: |
sales@jiejiegroup.com |
| Products Intro: |
Product Name:(R,R)-(+)-N,N'-BIS(ALPHA-METHYLBENZYL)SULFAMIDE CAS:91410-68-3 Purity:97% HPLC Package:100KG;1KG
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(R,R)-(+)-N,N′-Bis(α-methylbenzyl)sulfamide CAS:91410-68-3
|
(R,R)-(+)-N,N'-BIS(ALPHA-METHYLBENZYL)SULFAMIDE manufacturers
|
| | (R,R)-(+)-N,N'-BIS(ALPHA-METHYLBENZYL)SULFAMIDE Basic information |
| Product Name: | (R,R)-(+)-N,N'-BIS(ALPHA-METHYLBENZYL)SULFAMIDE | | Synonyms: | (R,R)-(+)-N,N'-BIS(ALPHA-METHYLBENZYL)SULFAMIDE;(R,R)-(+)-N,N-bis(A-methyl-benzyl)*sulfamide;(r,r)-(+)-n,n'-bis(α-methylbenzyl)sulfamide;(+)-N,N'-Sulfonylbis[(R)-α-methylbenzenemethanamine];Bis[[(R)-1-phenylethyl]amino] sulfone;Bis[[(R)-α-methylbenzyl]amino] sulfone;Sulfamide, N,N'-bis[(1R)-1-phenylethyl]-;(R,R)-(+)-N,N'-BIS(ALPHA-METHYLBENZYL)SULFAMIDE ISO 9001:2015 REACH | | CAS: | 91410-68-3 | | MF: | C16H20N2O2S | | MW: | 304.41 | | EINECS: | | | Product Categories: | Chiral Building Blocks;Organic Building Blocks;Sulfonamides/Sulfinamides | | Mol File: | 91410-68-3.mol |  |
| | (R,R)-(+)-N,N'-BIS(ALPHA-METHYLBENZYL)SULFAMIDE Chemical Properties |
| Melting point | 98-100 °C (lit.) | | Boiling point | 450.240±48.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.188±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 10.168±0.40(predicted) | | Optical Rotation | [α]20/D +80°, c = 2 in ethanol | | InChI | 1S/C16H20N2O2S/c1-13(15-9-5-3-6-10-15)17-21(19,20)18-14(2)16-11-7-4-8-12-16/h3-14,17-18H,1-2H3/t13-,14-/m1/s1 | | InChIKey | ZUMVQOILJDLACR-ZIAGYGMSSA-N | | SMILES | C[C@@H](NS(=O)(=O)N[C@H](C)c1ccccc1)c2ccccc2 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | (R,R)-(+)-N,N'-BIS(ALPHA-METHYLBENZYL)SULFAMIDE Usage And Synthesis |
| | (R,R)-(+)-N,N'-BIS(ALPHA-METHYLBENZYL)SULFAMIDE Preparation Products And Raw materials |
|