|
|
| | ALUMINUM PHENOXIDE Basic information |
| | ALUMINUM PHENOXIDE Chemical Properties |
| Melting point | 156 °C (dec.) (lit.) | | density | 1,23 g/cm3 | | form | solid | | InChI | 1S/3C6H6O.Al/c3*7-6-4-2-1-3-5-6;/h3*1-5,7H;/q;;;+3/p-3 | | InChIKey | OPSWAWSNPREEFQ-UHFFFAOYSA-K | | SMILES | O([Al](Oc1ccccc1)Oc2ccccc2)c3ccccc3 | | EPA Substance Registry System | Phenol, aluminum salt (15086-27-8) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | ALUMINUM PHENOXIDE Usage And Synthesis |
| reaction suitability | core: aluminum |
| | ALUMINUM PHENOXIDE Preparation Products And Raw materials |
|