| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- BROMOCHLOROACETIC ACID
-
- $12.00
-
2025-04-16
- CAS:5589-96-8
- Min. Order: 100kg
- Purity: 99%HPLC,USP Standard
- Supply Ability: 8000KGs
- BCAA
-
- $10.00
-
2024-09-18
- CAS:5589-96-8
- Min. Order: 1Kg/Bag
- Purity: 98%
- Supply Ability: 2500kg/month
|
| | Bromochloroacetic acid Basic information |
| | Bromochloroacetic acid Chemical Properties |
| Melting point | 27.5 °C(lit.) | | Boiling point | 210-212 °C767 mm Hg(lit.) | | density | 1.985 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.51(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly) | | pka | 1.39±0.10(Predicted) | | BRN | 1720556 | | InChI | InChI=1S/C2H2BrClO2/c3-1(4)2(5)6/h1H,(H,5,6) | | InChIKey | GEHJBWKLJVFKPS-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(Br)Cl | | CAS DataBase Reference | 5589-96-8 | | IARC | 2B (Vol. 101) 2013 | | EPA Substance Registry System | Bromochloroacetic acid (5589-96-8) |
| | Bromochloroacetic acid Usage And Synthesis |
| Uses | Bromochloroacetic acid is a halogenated disinfection byproduct commonly found in drinking water, fruit juice, and cheese. Bromochloroacetic acid has been shown to cause mesothelioma, fibroadenomas, and adenomas in rats | | Definition | ChEBI: Bromochloroacetic acid is a monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is replaced by bromine while a second is replaced by chlorine. A low-melting (27.5-31.5℃), hygroscopic crystalline solid, it can be formed during the disinfection (by chlorination) of water that contains bromide ions and organic matter, so can occur in drinking water as a byproduct of the disinfection process. It is a monocarboxylic acid, an organochlorine compound and a 2-bromocarboxylic acid. |
| | Bromochloroacetic acid Preparation Products And Raw materials |
|