|
|
| | 2-(2-BROMOACETYL)BENZONITRILE Basic information |
| Product Name: | 2-(2-BROMOACETYL)BENZONITRILE | | Synonyms: | 2-(2-BROMOACETYL)BENZONITRILE;BUTTPARK 41\03-53;2-(Bromoacetyl)benzonitrile;Benzonitrile, 2-(2-bromoacetyl)-;Unii-pyp30I3hvc;Bisphenol A Impurity 20 | | CAS: | 683274-86-4 | | MF: | C9H6BrNO | | MW: | 224.05 | | EINECS: | | | Product Categories: | | | Mol File: | 683274-86-4.mol |  |
| | 2-(2-BROMOACETYL)BENZONITRILE Chemical Properties |
| Boiling point | 334.7±22.0 °C(Predicted) | | density | 1.56±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | White | | InChI | InChI=1S/C9H6BrNO/c10-5-9(12)8-4-2-1-3-7(8)6-11/h1-4H,5H2 | | InChIKey | WVWHVTKOWVMEIM-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC=C1C(CBr)=O |
| | 2-(2-BROMOACETYL)BENZONITRILE Usage And Synthesis |
| Uses | 2-(2-Bromoacetyl)benzonitrile is a useful research chemical compound used in the preparation of heteroarylamine and heterocyclylamine compounds useful in treatment and prevention of metabolic diseases. |
| | 2-(2-BROMOACETYL)BENZONITRILE Preparation Products And Raw materials |
|