| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Tris(1H,1H,2H,2H-perfluorooctyl)tin bromide Basic information |
| Product Name: | Tris(1H,1H,2H,2H-perfluorooctyl)tin bromide | | Synonyms: | BROMOTRI(PERFLUOROHEXYLETHYL)STANNANE;BROMOTRIS(3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL)STANNANE;TRIS-(2-(PERFLUOROHEXYL)ETHYL)TIN BROMIDE;TRIS(3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL)TIN BROMIDE;Tris(1H,1H,2H,2H-perfluorooctyl)tin bromide, Bromotris(3,3,4,4,5,5,6,6,7,7,8,8,8- tridecafluorooctyl)stannane;Tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)tin bromide >=90%;Stannane, bromotris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-;Tris(1H,1H,2H,2H-perfluorooctyl)tin bromide | | CAS: | 175354-31-1 | | MF: | C24H12BrF39Sn | | MW: | 1239.9 | | EINECS: | | | Product Categories: | | | Mol File: | 175354-31-1.mol |  |
| | Tris(1H,1H,2H,2H-perfluorooctyl)tin bromide Chemical Properties |
| Boiling point | 431.8±55.0 °C(Predicted) | | density | 1.88 g/mL at 25 °C | | Fp | >149℃ | | form | liquid | | InChI | 1S/3C8H4F13.BrH.Sn/c3*1-2-3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;;/h3*1-2H2;1H;/q;;;;+1/p-1 | | InChIKey | JUIMYMQITJQCCQ-UHFFFAOYSA-M | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Sn](Br)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)tin bromide (175354-31-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-53 | | Safety Statements | 61 | | WGK Germany | 1 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tris(1H,1H,2H,2H-perfluorooctyl)tin bromide Usage And Synthesis |
| | Tris(1H,1H,2H,2H-perfluorooctyl)tin bromide Preparation Products And Raw materials |
|