| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,9,16,23-Tetra-tert-butyl-29H,31H-phthalocyanine Basic information | | Uses |
| Product Name: | 2,9,16,23-Tetra-tert-butyl-29H,31H-phthalocyanine | | Synonyms: | 2,9,16,23-Tetra-tert-butyl-29H,31H-phthalocyanine Dye content 97 %;29H,31H-Phthalocyanine, 2,9,16,23-tetrakis(1,1-dimethylethyl)-;2,9,16,23-Tetra-tert-butyl-29H,31H-phthalocyanine;2,9,16,23-Tetra-t-butyl-29h-31h-phthalocyanine;2,9,16,23-Tetra-tert-butyl-29H,31H-phthalocyanine | | CAS: | 35984-93-1 | | MF: | C48H50N8 | | MW: | 738.96 | | EINECS: | | | Product Categories: | Infrared (IR) DyesPhotonic and Optical Materials;Organic Electronics and Photonics;Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Phthalocyanines | | Mol File: | 35984-93-1.mol |  |
| | 2,9,16,23-Tetra-tert-butyl-29H,31H-phthalocyanine Chemical Properties |
| Melting point | >300 °C (lit.) | | density | 1.222±0.06 g/cm3(Predicted) | | form | solid | | λmax | 695 nm | | InChIKey | NNQWYGKROBKYQC-UHFFFAOYSA-N | | SMILES | C1C2=C(C3N([H])C2=NC2=NC(C4=C2C=CC(C(C)(C)C)=C4)=NC2N([H])C(=C4C=2C=CC(C(C)(C)C)=C4)N=C2N=C(C4=C2C=CC(C(C)(C)C)=C4)N=3)C=CC=1C(C)(C)C |c:23,41,t:7,57| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2,9,16,23-Tetra-tert-butyl-29H,31H-phthalocyanine Usage And Synthesis |
| Uses | 2,9,16,23-Tetratert-butyl-29H,31H-phthalocyanine can be used as a phthalocyanine dye. |
| | 2,9,16,23-Tetra-tert-butyl-29H,31H-phthalocyanine Preparation Products And Raw materials |
|