- (-)-Corey Lactone Diol
-
- $1.10 / 1g
-
2025-11-18
- CAS:76704-05-7
- Min. Order: 1g
- Purity: 99.9% Min
- Supply Ability: 100 Tons
- (-)-Corey Lactone Diol
-
- $65.00 / 1KG
-
2020-11-16
- CAS:76704-05-7
- Min. Order: 1KG
- Purity: 99
- Supply Ability: 1000KG
|
| | (-)-Corey Lactone Diol Basic information |
| Product Name: | (-)-Corey Lactone Diol | | Synonyms: | 2H-Cyclopenta[b]furan-2-one,hexahydro-5-hydroxy-4-(hydroxymethyl)-,(3aS,4R,5S,6aR)-;(3aR,4S,5R,6aS)-5-hydroxy-4-(hydroxyMethyl)-hexahydrocyclopenta[b]furan-2-one;(3aS,4R,5S,6aR)-5-Hydroxy-4-(hydroxyMethyl)hexahydro-2H-cyclopenta[b]furan-2-one;(3AS,4R,5S,6AR)-(+)-HEXAHYDRO-5-HYDROXY-4-(HYDROXYMETHYL)-2H-CYCLO-PENTA[B]FURAN-2-ONE;(3as,4R,5S,6ar)-(+)-hexahydro-5-hydroxy-4-hoch2-2;(3AS,4R,5S,6AR)-(+)-HEXAHYDRO-5-HYDROXY- 4-HOCH2-2H-CYCLOPENTA(B)FURAN-2-ONE, 98%;(3aR,5R,6R,6aS)-6-hydroxy-5-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one;(3aS,4R,5S,6aR)-(+)-Hexahydro-5-hydroxy-4-(hydroxymethyl)-2H-cyclopenta[b]furan-2-one 98% | | CAS: | 76704-05-7 | | MF: | C8H12O4 | | MW: | 172.18 | | EINECS: | | | Product Categories: | | | Mol File: | 76704-05-7.mol |  |
| | (-)-Corey Lactone Diol Chemical Properties |
| Melting point | 114-118 °C(lit.) | | alpha | -44 º (C=1.4 IN MEOH) | | Boiling point | 406.6±25.0 °C(Predicted) | | density | 1.365 | | storage temp. | 2-8°C | | pka | 14.36±0.40(Predicted) | | form | solid | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +44°, c = 2.3 in methanol | | InChI | InChI=1S/C8H12O4/c9-3-5-4-1-8(11)12-7(4)2-6(5)10/h4-7,9-10H,1-3H2/t4-,5-,6-,7+/m0/s1 | | InChIKey | VYTZWRCSPHQSFX-ZTYPAOSTSA-N | | SMILES | O1C(=O)C[C@@]2([H])[C@H](CO)[C@@H](O)C[C@@]12[H] | | CAS DataBase Reference | 76704-05-7 |
| WGK Germany | 3 | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids |
| | (-)-Corey Lactone Diol Usage And Synthesis |
| Chemical Properties | Solid | | Uses | (3aS,4R,5S,6aR)-Hexahydro-5-hydroxy-4-(hydroxymethyl)-2H-cyclopenta[b]furan-2-one (Bimatoprost Impurity 8) is an impurity of Bimatoprost (B386800), an antiglaucoma agent. Bimatoprost is also a synthetic prostamide; structurally related to prostaglandin F2α. |
| | (-)-Corey Lactone Diol Preparation Products And Raw materials |
|