| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Dimethyl (2-oxo-4-phenylbutyl)phosphonate Basic information |
| | Dimethyl (2-oxo-4-phenylbutyl)phosphonate Chemical Properties |
| Boiling point | 120-122 °C (0.5 mmHg) | | density | 1.152±0.06 g/cm3(Predicted) | | Fp | >110°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | color | Pale Yellow to Light Yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C12H17O4P/c1-15-17(14,16-2)10-12(13)9-8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3 | | InChIKey | ONYIBVIIOCEBIV-UHFFFAOYSA-N | | SMILES | P(CC(=O)CCC1=CC=CC=C1)(=O)(OC)OC | | CAS DataBase Reference | 41162-19-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | HS Code | 2931499090 |
| Provider | Language |
|
ACROS
| English |
| | Dimethyl (2-oxo-4-phenylbutyl)phosphonate Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | Dimethyl (2-Oxo-4-phenylbutyl)phosphonate (Bimatoprost Impurity 12) is an impurity of Bimatoprost (B386800), an antiglaucoma agent. Bimatoprost is also a synthetic prostamide; structurally related to prostaglandin F2α. |
| | Dimethyl (2-oxo-4-phenylbutyl)phosphonate Preparation Products And Raw materials |
|