| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acetanilide manufacturers
|
| | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acetanilide Basic information |
| Product Name: | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acetanilide | | Synonyms: | (2-ACETAMIDYL)PHENYL-3-BORONIC ACID PINACOL ESTER;3'-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ACETANILIDE;3-ACETAMIDOPHENYLBORONIC ACID, PINACOL ESTER;3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acetanilide ,98%;3-(Acetamido)benzeneboronic acid, pinacol ester;3-Acetamidophenylboronic acid, pinacol estet;3'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acetanilide, 3-(Acetylamino)benzeneboronic acid, pinacol ester;N-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetaMide | | CAS: | 480424-93-9 | | MF: | C14H20BNO3 | | MW: | 261.12 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 480424-93-9.mol |  |
| | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acetanilide Chemical Properties |
| Melting point | 185-190 °C(lit.) | | Boiling point | 430.3±28.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 15.23±0.70(Predicted) | | color | White to Almost white | | λmax | 286nm(EtOH)(lit.) | | InChI | 1S/C14H20BNO3/c1-10(17)16-12-8-6-7-11(9-12)15-18-13(2,3)14(4,5)19-15/h6-9H,1-5H3,(H,16,17) | | InChIKey | CZFSGYCLOCCASM-UHFFFAOYSA-N | | SMILES | CC(=O)Nc1cccc(c1)B2OC(C)(C)C(C)(C)O2 | | CAS DataBase Reference | 480424-93-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acetanilide Usage And Synthesis |
| Chemical Properties | Red to brown powder | | Uses | suzuki reaction |
| | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acetanilide Preparation Products And Raw materials |
|