| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Sodium hexafluoroacetylacetonate manufacturers
|
| | Sodium hexafluoroacetylacetonate Basic information |
| Product Name: | Sodium hexafluoroacetylacetonate | | Synonyms: | Nsc174351;SODIUM HEXAFLUOROPENTANEDIONATE;SODIUM HEXAFLUORO-2,4-PENTANEDIONATE;SODIUMHEXAFLUOROACETYLACETONATE,97%;sodium:(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;Sodium 1,1,1,5,5,5-hexafluoroacetylacetonate;Sodium 2,2,6,6-tetramethyl-3,5-dioxoheptan-4-ide;Sodium hexafluoroacetylacetonate 97% | | CAS: | 22466-49-5 | | MF: | C5HF6NaO2 | | MW: | 230.04 | | EINECS: | | | Product Categories: | Micro/Nanoelectronics;Solution Deposition Precursors | | Mol File: | 22466-49-5.mol |  |
| | Sodium hexafluoroacetylacetonate Chemical Properties |
| Melting point | 230°C (dec.) | | form | Powder | | color | white | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Stability: | hygroscopic | | InChI | 1S/C5H2F6O2.Na/c6-4(7,8)2(12)1-3(13)5(9,10)11;/h1,12H;/q;+1/p-1/b2-1-; | | InChIKey | AWUDPEKDPFGDOP-ODZAUARKSA-M | | SMILES | [Na+].[O-]\C(=C/C(=O)C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Sodium hexafluoroacetylacetonate Usage And Synthesis |
| Uses | Recently employed in the solid-phase synthesis of chromium β-diketonates, in the preparation of novel catalytic ruthenium diphosphine complexes and in the preparation of a series of new copper chemical vapor deposition (CVD) precursors. | | reaction suitability | core: sodium |
| | Sodium hexafluoroacetylacetonate Preparation Products And Raw materials |
|