| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
alpha-Naphthyl acid phosphate monopotassium salt manufacturers
|
| | alpha-Naphthyl acid phosphate monopotassium salt Basic information |
| Product Name: | alpha-Naphthyl acid phosphate monopotassium salt | | Synonyms: | 1-NAPHTHYL PHOSPHATE POTASSIUM SALT;A-naphthyl acid phosphate monopotassium;α-naphthyl acid phosphate monopotassium salt;1-Naphthyl phosphate potassium salt powder;1-Naphthyl acid phosphate monopotassium salt;1-Naphthalenol,dihydrogen phosphate, monopotassium salt (9CI);NickFect1,Inhibitor,splice-correcting,NF2,1-Naphthyl phosphate,PF3,inhibit,Phosphatase,TP10,NickFect2,NF1,1 Naphthyl phosphate potassium salt,1Naphthyl phosphate potassium salt;1-Naphthyl phosphate potassium salt, 10 mM in DMSO | | CAS: | 100929-85-9 | | MF: | C10H8KO4P | | MW: | 262.24 | | EINECS: | | | Product Categories: | | | Mol File: | 100929-85-9.mol |  |
| | alpha-Naphthyl acid phosphate monopotassium salt Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: 50 mg/mL | | form | powder | | color | white to faint yellow | | Water Solubility | H2O: 50mg/mL | | InChI | 1S/C10H9O4P.K.H/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,(H2,11,12,13);; | | InChIKey | AJEYDRMDDMSWCS-UHFFFAOYSA-N | | SMILES | [K].OP(O)(=O)Oc1cccc2ccccc12 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | alpha-Naphthyl acid phosphate monopotassium salt Usage And Synthesis |
| Uses | 1-Naphthyl phosphate potassium salt is a non-specific phosphatase inhibitor. 1-Naphthyl phosphate potassium salt decreases the splice-correcting effect[1]. | | Biochem/physiol Actions | Non-specific phosphatase inhibitor. Inhibits acid, alkaline and protein phosphatases. | | References | [1] Nikita Oskolkov, et al. NickFects, Phosphorylated Derivatives of Transportan 10 for Cellular Delivery of Oligonucleotides. International Journal of Peptide Research and Therapeutics volume 17, Article number: 147 (2011). |
| | alpha-Naphthyl acid phosphate monopotassium salt Preparation Products And Raw materials |
|