| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | Benzothiazole-6-carboxylic acid Basic information |
| Product Name: | Benzothiazole-6-carboxylic acid | | Synonyms: | BUTTPARK 29\06-35;6-Benzothiazolecarboxylicacid(6CI,7CI,8CI,9CI);6-BENZOTHIAZOLECARBOXYLIC ACID;1,3-BENZOTHIAZOLE-6-CARBOXYLIC ACID;1,3-Benzothiazole-6-carboxylic acid ,98%;1,3-Benzothiazole-6-carboxylic acid ,97%;1,3-Benzothiazole-6-carboxylic acid, tech;6-Carboxy-1,3-benzothiazole | | CAS: | 3622-35-3 | | MF: | C8H5NO2S | | MW: | 179.2 | | EINECS: | | | Product Categories: | BENZOTHIAZOLE;Carboxylic Acids;Thiazoles, Isothiazoles &Benzothiazoles;Carboxylic Acids;Thiazoles, Isothiazoles & Benzothiazoles;Building Blocks;Heterocyclic Building Blocks;Thiazoles | | Mol File: | 3622-35-3.mol |  |
| | Benzothiazole-6-carboxylic acid Chemical Properties |
| Melting point | 245-251 °C(lit.) | | Boiling point | 387.7±15.0 °C(Predicted) | | density | 1.508±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.70±0.30(Predicted) | | form | Powder | | color | White to pale brown | | InChI | InChI=1S/C8H5NO2S/c10-8(11)5-1-2-6-7(3-5)12-4-9-6/h1-4H,(H,10,11) | | InChIKey | DMPZJACLHDWUFS-UHFFFAOYSA-N | | SMILES | S1C2=CC(C(O)=O)=CC=C2N=C1 | | CAS DataBase Reference | 3622-35-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-26 37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Benzothiazole-6-carboxylic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Benzothiazole-6-carboxylic acid may be used in the synthesis of N-(pyridin-4-yl)benzo[d]thiazole-6-carboxamide, which shows the potential to inhibit K1 capsule formation in uropathogenic Escherichia coli. It may also be used as an internal standard during the quantification of benzothiazoles by liquid chromatography-electrospray ionization-tandem mass spectrometry. | | General Description | Benzothiazole-6-carboxylic acid (BTCA) is a benzothiazole derivative. |
| | Benzothiazole-6-carboxylic acid Preparation Products And Raw materials |
|