- DODECYLAMINE ACETATE
-
- $1.00
-
2020-01-10
- CAS:2016-56-0
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 200kgs
|
| | Dodecylamine acetate Basic information |
| Product Name: | Dodecylamine acetate | | Synonyms: | 1-Dodecanamine, acetate (1:1);1-Dodecanamine,acetate;1-Dodecanamineacetate(salt);1-dodecylamineacetate;dodecanamineacetate;dodecylammoniumacetate;LAURYLAMINE ACETATE EP;n-Laurylamine acetate | | CAS: | 2016-56-0 | | MF: | C14H31NO2 | | MW: | 245.4 | | EINECS: | 217-956-1 | | Product Categories: | | | Mol File: | 2016-56-0.mol |  |
| | Dodecylamine acetate Chemical Properties |
| Melting point | 69°C | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | very faint turbidity | | InChI | InChI=1S/C12H27N.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13;1-2(3)4/h2-13H2,1H3;1H3,(H,3,4) | | InChIKey | HBRNMIYLJIXXEE-UHFFFAOYSA-N | | SMILES | C(C)(=O)O.C(CCCCCN)CCCCCC | | CAS DataBase Reference | 2016-56-0(CAS DataBase Reference) | | EPA Substance Registry System | 1-Dodecanamine acetate (2016-56-0) |
| Risk Statements | 20/21/22 | | Safety Statements | 22-36/37/39 | | RTECS | JR6490000 | | TSCA | TSCA listed | | HS Code | 2921.19.6190 |
| | Dodecylamine acetate Usage And Synthesis |
| Uses | Dodecylamine Acetate (CAS# 2016-56-0) is a useful research chemical compound. It is used in a method for producing light magnesium carbonate. |
| | Dodecylamine acetate Preparation Products And Raw materials |
|