2-Tetrahydrofuranyl methacrylate manufacturers
|
| | 2-Tetrahydrofuranyl methacrylate Basic information | | Uses |
| Product Name: | 2-Tetrahydrofuranyl methacrylate | | Synonyms: | 2-Tetrahydrofuranyl methacrylate;2-Propenoic acid, 2-methyl-, tetrahydro-2-furanyl ester;2-tetrehydrofuranyl methacrylate;oxolan-2-yl 2-methylprop-2-enoate;15895-80-4 2-Tetrahydrofuranyl methacrylate supplier;Tetrahydrofuran-2-YL methacrylate | | CAS: | 15895-80-4 | | MF: | C8H12O3 | | MW: | 156.18 | | EINECS: | | | Product Categories: | monomer | | Mol File: | 15895-80-4.mol |  |
| | 2-Tetrahydrofuranyl methacrylate Chemical Properties |
| Boiling point | 80-83 °C(Press: 3 Torr) | | density | 1.04 g/cm3 | | InChI | InChI=1S/C8H12O3/c1-6(2)8(9)11-7-4-3-5-10-7/h7H,1,3-5H2,2H3 | | InChIKey | CSVRUJBOWHSVMA-UHFFFAOYSA-N | | SMILES | C(OC1CCCO1)(=O)C(C)=C |
| | 2-Tetrahydrofuranyl methacrylate Usage And Synthesis |
| Uses | 2-Tetrahydrofuranyl methacrylate is a carboxylic acid ester derivative that can be used as a pharmaceutical intermediate. |
| | 2-Tetrahydrofuranyl methacrylate Preparation Products And Raw materials |
|