|
|
| | (R)-3-(Boc-amino)pyrrolidine Basic information |
| | (R)-3-(Boc-amino)pyrrolidine Chemical Properties |
| Melting point | 50 °C | | Boiling point | 286.4±29.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | refractive index | 20 ° (C=1, EtOH) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 12.37±0.20(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | Optical Rotation | [α]/D +21.5±1.5°, c = 1 in ethanol | | Water Solubility | Soluble in water. | | Sensitive | Air Sensitive | | BRN | 5377812 | | InChI | InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)11-7-4-5-10-6-7/h7,10H,4-6H2,1-3H3,(H,11,12)/t7-/m1/s1 | | InChIKey | DQQJBEAXSOOCPG-SSDOTTSWSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCNC1 | | CAS DataBase Reference | 122536-77-0(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | UN3259 | | WGK Germany | 3 | | F | 10-23 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-3-(Boc-amino)pyrrolidine Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | (R)-(+)-3-(Boc-amino)pyrrolidine is used as an intermediate in organic synthesis, as pharmaceutical intermediate. |
| | (R)-3-(Boc-amino)pyrrolidine Preparation Products And Raw materials |
|