| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate Basic information |
| Product Name: | Ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate | | Synonyms: | OTAVA-BB BB0129720147;2-AMINO-4-(3,4-DIMETHYL-PHENYL)-THIOPHENE-3-CARBOXYLIC ACID ETHYL ESTER;3-THIOPHENECARBOXYLIC ACID, 2-AMINO-4-(3,4-DIMETHYLPHENYL)-, ETHYL ESTER;AKOS BBS-00000857;CHEMBRDG-BB 3000794;AURORA 20384;ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate(SALTDATA: FREE);Ethyl 2-amino-4-(3,4-dimethylphenyl)-3-thiophenecarboxylate | | CAS: | 307511-65-5 | | MF: | C15H17NO2S | | MW: | 275.37 | | EINECS: | | | Product Categories: | | | Mol File: | 307511-65-5.mol |  |
| | Ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate Chemical Properties |
| Melting point | 80-83℃ | | Boiling point | 411.5±45.0 °C(Predicted) | | density | 1.179±0.06 g/cm3(Predicted) | | pka | -0.04±0.14(Predicted) | | form | solid | | InChI | 1S/C15H17NO2S/c1-4-18-15(17)13-12(8-19-14(13)16)11-6-5-9(2)10(3)7-11/h5-8H,4,16H2,1-3H3 | | InChIKey | KLIHUUITIBDJMQ-UHFFFAOYSA-N | | SMILES | [s]1c(c(c(c1)c2cc(c(cc2)C)C)C(=O)OCC)N | | CAS DataBase Reference | 307511-65-5 |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate Usage And Synthesis |
| Uses | Ethyl 2-Amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate is a useful reagent for synthesis and evaluation of substituted (thieno[2,3-d]pyrimidin-4-ylthio)carboxylic acids as inhibitors of human protein kinase CK2. |
| | Ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate Preparation Products And Raw materials |
|