| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2-((3,5-Dimethyl-4-hydroxyphenyl)-methylene)-4-cyclopentene-1,3-dione Basic information |
| | 2-((3,5-Dimethyl-4-hydroxyphenyl)-methylene)-4-cyclopentene-1,3-dione Chemical Properties |
| Boiling point | 436.2±44.0 °C(Predicted) | | density | 1.313±0.06 g/cm3(Predicted) | | storage temp. | +2C to +8C | | solubility | DMF: slightly; DMSO: 0.33 mg/ml; Ethanol: slightly | | form | Light orange solid | | pka | 9.47±0.40(Predicted) | | color | light orange | | InChI | 1S/C14H12O3/c1-8-5-10(6-9(2)14(8)17)7-11-12(15)3-4-13(11)16/h3-7,17H,1-2H3 | | InChIKey | YHWRISYBKMXSGJ-UHFFFAOYSA-N | | SMILES | Oc1c(cc(cc1C)C=C2C(=O)C=CC2=O)C |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | 2-((3,5-Dimethyl-4-hydroxyphenyl)-methylene)-4-cyclopentene-1,3-dione Usage And Synthesis |
| Uses | TX-1918 is a potent inhibitor for eEF2K. | | Biological Activity | Cell permeable: yes', 'Primary Target
eEF2-K', 'Product does not compete with ATP.', 'Reversible: no', 'Target IC50: 440 nM against eEF2-K |
| | 2-((3,5-Dimethyl-4-hydroxyphenyl)-methylene)-4-cyclopentene-1,3-dione Preparation Products And Raw materials |
|