| Company Name: |
Sigma-Aldrich Gold |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-Dimethyl L-tartrate Basic information |
| Product Name: | (+)-Dimethyl L-tartrate | | Synonyms: | Butanedioic acid, 2,3-dihydroxy- [R-(R*,R*)]-, dimethyl ester;Dimethyl (2R,3R)-2,3-dihydroxybutanedioate;(+)-Tartaric acid dimethyl;(2R,3R)-2,3-Dihydroxybutanedioic acid dimethyl ester;L-(+)-Tartaric acid dimethyl;(+)-Dimethyl L-tartrate,99%;L-DiMethyl L-tartrate;L-(+)-Tartaric acid diMethyl ester, 99%, ee: 99% | | CAS: | 608-68-4 | | MF: | C6H10O6 | | MW: | 178.14 | | EINECS: | 210-166-8 | | Product Categories: | Chiral Compound;FINE Chemical & INTERMEDIATES;Chiral Compounds;chiral;Chiral Building Blocks;Esters (Chiral);Synthetic Organic Chemistry;CHIRAL CHEMICALS;Hydroxy Acids & Deriv. | | Mol File: | 608-68-4.mol |  |
| | (+)-Dimethyl L-tartrate Chemical Properties |
| Melting point | 57-60 °C (dec.) (lit.) | | alpha | 21 º (c=10, H2O) | | Boiling point | 163 °C/23 mmHg (lit.) | | density | 1.238 g/mL at 25 °C (lit.) | | refractive index | 21 ° (C=2.5, H2O) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | pka | 11.44±0.20(Predicted) | | form | Crystals | | Specific Gravity | 1.3046 (50/4℃) | | color | White | | Optical Rotation | [α]22/D +21°, c = 2.5 in H2O | | Water Solubility | Soluble in water. | | BRN | 1726256 | | InChI | 1S/C6H10O6/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4,7-8H,1-2H3/t3-,4-/m1/s1 | | InChIKey | PVRATXCXJDHJJN-QWWZWVQMSA-N | | SMILES | COC(=O)[C@H](O)[C@@H](O)C(=O)OC | | LogP | -1.350 (est) | | CAS DataBase Reference | 608-68-4(CAS DataBase Reference) | | NIST Chemistry Reference | Butanedioic acid, 2,3-dihydroxy- [R-(R*,R*)]-, dimethyl ester(608-68-4) | | EPA Substance Registry System | Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, dimethyl ester (608-68-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36/37-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29181300 | | Storage Class | 11 - Combustible Solids |
| | (+)-Dimethyl L-tartrate Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (+)-Dimethyl L-tartrate is used as a starting reagent in the synthesis of (+)-Monomorine I, a pyrrolidine-based alkaloid that is a trail pheromone of the Pharaoh’s ant (Monomorium pharaonis). | | Uses | (+)-Dimethyl L-tartrate can react with sulfur tetrafluoride to form dimethyl meso-2,3-difluorosuccinate. It may be used in the synthesis of the following chiral ligands for use in asymmetric synthesis:
- (2R, 3R)-1,4-dimethoxy-1,1,4,4-tetraphenyl-2,3-butanediol
- (-)-(4S,5R)-4-(2-pyridyl)-5-(diphenylphosphino)methyl-2,2-dimethyl-1,3-dioxolane (PYDIPHOS)
- (4R,5R)-α,α,α′,α′-2,2-hexaphenyl-4,5-dimethanol-1,3-dioxolane
|
| | (+)-Dimethyl L-tartrate Preparation Products And Raw materials |
|