| Company Name: |
Shanghai Hope Chem Co., Ltd.， Gold
|
| Tel: |
+21-18501659228 18501659228 |
| Email: |
info@hope-chem.com |
| Products Intro: |
Product Name:Z-Phe-Lys(Boc)-COCH2Cl
CAS:1456879-69-8
Package:1KG;10KG
|
|
| | Z-Phe-Lys(Boc)-COCH2Cl Basic information |
| Product Name: | Z-Phe-Lys(Boc)-COCH2Cl | | Synonyms: | Z-Phe-Lys(Boc)-COCH2Cl;tert-butyl N-[(5S)-5-[(2S)-2-{[(benzyloxy)carbonyl]amino}-3-phenylpropanamido]-7-chloro-6-oxoheptyl]carbamate;13-Oxa-2,5,11-triazapentadecanoic acid, 6-(2-chloroacetyl)-14,14-dimethyl-4,12-dioxo-3-(phenylmethyl)-, phenylmethyl ester, (3S,6S)-;tert-Butyl N-[(5S)-5-[(2S)-2-(Cbz-amino)-3-phenylpropanamido]-7-chloro-6-oxoheptyl]carbamate | | CAS: | 1456879-69-8 | | MF: | C29H38ClN3O6 | | MW: | 560.08 | | EINECS: | | | Product Categories: | | | Mol File: | 1456879-69-8.mol |  |
| | Z-Phe-Lys(Boc)-COCH2Cl Chemical Properties |
| Boiling point | 783.5±60.0 °C(Predicted) | | density | 1.190±0.06 g/cm3(Predicted) | | pka | 11.07±0.46(Predicted) | | InChIKey | IFWBBOHDSVOIDW-ZEQRLZLVSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@H](C(CCl)=O)CCCCNC(=O)OC(C)(C)C |
| | Z-Phe-Lys(Boc)-COCH2Cl Usage And Synthesis |
| | Z-Phe-Lys(Boc)-COCH2Cl Preparation Products And Raw materials |
|