|
|
| | triphenylsulfanium 2-(trifluoromethyl)benzene-1-sulfonate Basic information |
| Product Name: | triphenylsulfanium 2-(trifluoromethyl)benzene-1-sulfonate | | Synonyms: | triphenylsulfanium 2-(trifluoromethyl)benzene-1-sulfonate;Triphenytl sulfonium trifluoro methyl benzene
sulfonate;Triphenylsulfonium, 2-(trifluoromethyl)benzenesulfonate(1:1);Triphenylsulfonium trifluorobenzenesulfonate;triphenylsulfonium 2-(trifluoromethyl)benzenesulfonate | | CAS: | 425670-97-9 | | MF: | C25H19F3O3S2 | | MW: | 488.54 | | EINECS: | 682-855-5 | | Product Categories: | | | Mol File: | 425670-97-9.mol |  |
| | triphenylsulfanium 2-(trifluoromethyl)benzene-1-sulfonate Chemical Properties |
| InChI | InChI=1S/C18H15S.C7H5F3O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h1-15H;1-4H,(H,11,12,13)/q+1;/p-1 | | InChIKey | GDQWVPZPTFVESV-UHFFFAOYSA-M | | SMILES | [S+](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.C(C1C=CC=CC=1S([O-])(=O)=O)(F)(F)F |
| | triphenylsulfanium 2-(trifluoromethyl)benzene-1-sulfonate Usage And Synthesis |
| Uses | Triphenylsulfanium 2-(trifluoromethyl)benzene-1-sulfonate is a white solid, widely used in organic synthesis, with excellent solubility in organic solvents, playing a crucial role as a reagent in various chemical reactions. |
| | triphenylsulfanium 2-(trifluoromethyl)benzene-1-sulfonate Preparation Products And Raw materials |
|