| Company Name: |
ChemStrong Scientific Co.,Ltd
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Vildagliptin Impurity 43
CAS:1563006-28-9
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
|
| | Vildagliptin Impurity 25 Basic information |
| Product Name: | Vildagliptin Impurity 25 | | Synonyms: | 2-Pyrrolidinecarbonitrile, 1-(2-hydroxyacetyl)-, (2S)-;Vildagliptin Impurity 25Q: What is
Vildagliptin Impurity 25 Q: What is the CAS Number of
Vildagliptin Impurity 25 Q: What is the storage condition of
Vildagliptin Impurity 25;(S)-1-(2-Hydroxyacetyl)pyrrolidine-2-carbonitrile;(S)-1-(2,2,2-trichloroacetyl)pyrrolidine-2-carbonitrile;(S)-1-(2-Hydroxyacetyl)pyrrolidine-2-carbonitrile (Vildagliptin Impurity） | | CAS: | 1563006-28-9 | | MF: | C7H10N2O2 | | MW: | 154.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1563006-28-9.mol |  |
| | Vildagliptin Impurity 25 Chemical Properties |
| Boiling point | 399.6±37.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 13.58±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H10N2O2/c8-4-6-2-1-3-9(6)7(11)5-10/h6,10H,1-3,5H2/t6-/m0/s1 | | InChIKey | HOAXAMIXIJSFGP-LURJTMIESA-N | | SMILES | N1(C(CO)=O)CCC[C@H]1C#N |
| | Vildagliptin Impurity 25 Usage And Synthesis |
| | Vildagliptin Impurity 25 Preparation Products And Raw materials |
|