|
|
| | Diethyl-d10-amine hydrochloride Basic information |
| | Diethyl-d10-amine hydrochloride Chemical Properties |
| Melting point | 227-230 °C(lit.) | | form | solid | | InChI | InChI=1S/C4H11N.ClH/c1-3-5-4-2;/h5H,3-4H2,1-2H3;1H | | InChIKey | HDITUCONWLWUJR-UHFFFAOYSA-N | | SMILES | N(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])[H].Cl |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 1 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1A Skin Sens. 1 STOT SE 3 |
| | Diethyl-d10-amine hydrochloride Usage And Synthesis |
| Uses | Diethyl-d10-amine HCl (CAS# 285132-87-8) is a useful isotopically labeled research compound. |
| | Diethyl-d10-amine hydrochloride Preparation Products And Raw materials |
|