|
|
| | 4,4'-Dianilino-1,1'-binaphthyl-5,5'-disulfonic acid dipotassium salt Basic information |
| Product Name: | 4,4'-Dianilino-1,1'-binaphthyl-5,5'-disulfonic acid dipotassium salt | | Synonyms: | 4,4'-Bis(1-anilinonaphthalene-8-sulfonic Acid) DipotassiuM Salt;4,4'-Bis(phenylaMino)-[1,1'-binaphthalene]-5,5'-disulfonic Acid PotassiuM Salt;8-Anilino-1-naphthalenesulfonic Acid Di;4,4'-DIANILINO-1,1'-BINAPHTHYL-5,5'-DISULFONIC ACID DIPOTASSIUM SALT;4,4'-DIANILINO-1,1'-BINAPHTHYL-5,5'-DISULFONIC ACID, POTASSIUM SALT;BIS-(5,5')-8-ANILINO-1-NAPHTHALENE SULFONIC ACID DIPOTASSIUM SALT;BIS-ANS DIPOTASSIUM SALT;4,4'-dianilino-1,1'-binaphthyl-5,5'-di-sulfonic A | | CAS: | 65664-81-5 | | MF: | C32H22K2N2O6S2 | | MW: | 672.85 | | EINECS: | | | Product Categories: | Amines;Fluorescent Labels & Indicators;Sulfur & Selenium Compounds;Aromatics;Miscellaneous | | Mol File: | 65664-81-5.mol |  |
| | 4,4'-Dianilino-1,1'-binaphthyl-5,5'-disulfonic acid dipotassium salt Chemical Properties |
| storage temp. | Store at -20°C, protect from light | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: slightly soluble; PBS (pH 7.2): 5 mg/ml | | form | A crystalline solid | | color | light yellow | | Appearance | light yellow-green crystals | | BRN | 5714637 | | InChIKey | VWLWTJHKQHRTNC-UHFFFAOYSA-L | | SMILES | [K+].[K+].[O-]S(=O)(=O)c1cccc2c(ccc(Nc3ccccc3)c12)-c4ccc(Nc5ccccc5)c6c(cccc46)S([O-])(=O)=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4,4'-Dianilino-1,1'-binaphthyl-5,5'-disulfonic acid dipotassium salt Usage And Synthesis |
| Description | Bis-ANS is a high-affinity fluorescent probe for nonpolar cavities in proteins. Its hydrophobic phenyl and naphthyl rings interact noncovalently with proteins and protein degradation products.
As with other anilinonaphthalene sulfonates (ANS), bis-ANS is essentially nonfluorescent in water but becomes noticeably fluorescent in a nonpolar environment. When free, bis-ANS has an excitation maximum at 390 nm and an emission maximum at 523 nm but undergoes a blue shift with an increase in fluorescence intensity when bound to protein.
Bis-ANS is frequently used to monitor the formation of protein aggregates and indicate protein folding and conformational changes. The dye is also used to detect Aβ fibers. | | Uses | 4,4'-Dianilino-1,1'-binaphthyl-5,5'-disulfonic Acid is a bifunctional fluorescent probe for proteins. | | Uses | 4,4''-Dianilino-1,1''-binaphthyl-5,5''-disulfonic Acid is a bifunctional fluorescent probe for proteins. | | Abs/Em Maxima | 396 (free), 401 (complex)/508 (free), 488 (complex) nm | | Excitation / Emission Maximum | 390 nm (free), 484 nm (bound)/523 nm (free), 496 nm (bound) |
| | 4,4'-Dianilino-1,1'-binaphthyl-5,5'-disulfonic acid dipotassium salt Preparation Products And Raw materials |
|