| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
N-(4-Hydroxyphenyl)methacrylamide manufacturers
|
| | N-(4-Hydroxyphenyl)methacrylamide Basic information |
| Product Name: | N-(4-Hydroxyphenyl)methacrylamide | | Synonyms: | N-(p-Hydroxyphenyl)methacrylChemicalbookamine;N-(4-hydroxyphenyl)-2-methylprop-2-enamide;4’-hydroxy-2-methyl-acrylanilid;4’-Hydroxy-2-methylacrylanilide;4’-hydroxy-2-methyl-Acrylanilide;Acrylanilide,4’-hydroxy-2-methyl-;n-(4-hydroxyphenyl)-2-methyl-2-propenamid;N-(4-Hydroxyphenyl)-2-methyl-2-propenamide | | CAS: | 19243-95-9 | | MF: | C10H11NO2 | | MW: | 177.2 | | EINECS: | | | Product Categories: | monomer | | Mol File: | 19243-95-9.mol |  |
| | N-(4-Hydroxyphenyl)methacrylamide Chemical Properties |
| Melting point | 154 °C | | Boiling point | 390.2±34.0 °C(Predicted) | | density | 1.190±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Acetone | | form | powder to crystal | | pka | 9.98±0.26(Predicted) | | color | White to Gray to Brown | | InChI | InChI=1S/C10H11NO2/c1-7(2)10(13)11-8-3-5-9(12)6-4-8/h3-6,12H,1H2,2H3,(H,11,13) | | InChIKey | XZSZONUJSGDIFI-UHFFFAOYSA-N | | SMILES | C(NC1=CC=C(O)C=C1)(=O)C(C)=C | | CAS DataBase Reference | 19243-95-9 |
| WGK Germany | WGK 3 | | RTECS | AS4055000 | | HS Code | 2924297099 | | Storage Class | 13 - Non Combustible Solids |
| | N-(4-Hydroxyphenyl)methacrylamide Usage And Synthesis |
| Uses | Monomer for biomedical and lithographic applications. May be used to make polymer substrates that support cell expansion and differentiation. |
| | N-(4-Hydroxyphenyl)methacrylamide Preparation Products And Raw materials |
|