| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Benzyloxy-trans-beta-nitrostyrene 97 Basic information |
| Product Name: | 4-Benzyloxy-trans-beta-nitrostyrene 97 | | Synonyms: | 4-benzyloxy-trans-β-nitrostyrene;(E)-1-(benzyloxy)-4-(2-nitrovinyl)benzene;1-(Benzyloxy)-4-(2-nitrovinyl)benzene;Benzene, 1-(2-nitroethenyl)-4-(phenylmethoxy)-;4-Benzyloxy-β-nitroestyrene;4-Benzyloxy-trans-β-nitrostyrene;4-Benzyloxy-trans-β-nitrostyrene, CAS 2982-55-0;1-(Benzyloxy)-4-(2-nitrovinyl)benzene - [B93702] | | CAS: | 2982-55-0 | | MF: | C15H13NO3 | | MW: | 255.27 | | EINECS: | | | Product Categories: | Acyclic;Alkenes;Organic Building Blocks | | Mol File: | 2982-55-0.mol |  |
| | 4-Benzyloxy-trans-beta-nitrostyrene 97 Chemical Properties |
| Melting point | 121-125 °C (lit.) | | Boiling point | 427.9±25.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | solid | | Appearance | Yellow to brown Solid | | InChI | 1S/C15H13NO3/c17-16(18)11-10-13-6-8-15(9-7-13)19-12-14-4-2-1-3-5-14/h1-11H,12H2 | | InChIKey | MSDHJAWQEZOXGV-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)\C=C\c1ccc(OCc2ccccc2)cc1 |
| Hazard Codes | Xi,N | | Risk Statements | 41-51/53 | | Safety Statements | 26-36/37/39-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | 4-Benzyloxy-trans-beta-nitrostyrene 97 Usage And Synthesis |
| | 4-Benzyloxy-trans-beta-nitrostyrene 97 Preparation Products And Raw materials |
|