|
|
| | Bis(1-benzotriazolyl)methanethione 97 Basic information |
| Product Name: | Bis(1-benzotriazolyl)methanethione 97 | | Synonyms: | Bis(1H-benzotriazol-1-yl)methanethione;bis(1H-benzo[d][1,2,3]triazol-1-yl)Methanethione;1,1′-(Thiocarbonyl)bis-1H-benzotriazole;Bis(1-benzotriazolyl)methanethione 97%;Methanethione, bis(1H-benzotriazol-1-yl)-;Bis(1H-benzo[d][1,2,3]triazol-1-yl)methanethione - [B72895];di(1-benzenebenzotriazoleyl)methylthione;Bis(1-benzotriazolyl)methanethione 97 | | CAS: | 4314-19-6 | | MF: | C13H8N6S | | MW: | 280.31 | | EINECS: | | | Product Categories: | C-C Bond Formation;Others;Synthetic Reagents | | Mol File: | 4314-19-6.mol |  |
| | Bis(1-benzotriazolyl)methanethione 97 Chemical Properties |
| Melting point | 170-174 °C (lit.) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C13H8N6S/c20-13(18-11-7-3-1-5-9(11)14-16-18)19-12-8-4-2-6-10(12)15-17-19/h1-8H | | InChIKey | ZRXHYHZENMJKMG-UHFFFAOYSA-N | | SMILES | S=C(n1nnc2ccccc12)n3nnc4ccccc34 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bis(1-benzotriazolyl)methanethione 97 Usage And Synthesis |
| Uses | New Benzotriazole Reagents
Reactant used as a thioacylating agent
Reactant involved in:
- Multicomponent heterocyclization reactions
- Synthesis of substituted thiosemicarbazides and N-hydroxythioureas
- Guanylation of amines
| | reaction suitability | reaction type: C-C Bond Formation |
| | Bis(1-benzotriazolyl)methanethione 97 Preparation Products And Raw materials |
|