tert-Amylperoxy 2-ethylhexyl carbonate manufacturers
|
| | tert-Amylperoxy 2-ethylhexyl carbonate Basic information |
| Product Name: | tert-Amylperoxy 2-ethylhexyl carbonate | | Synonyms: | carbonoperoxoicacid,oo-(1,1-dimethylpropyl)o-(2-ethylhexyl)ester;O,O-(1,1-Dimethylpropyl) O-(2-ethylhexyl) carbonoperoxoate;O,O-tert-Amyl-O-(2-ethylhexyl)-peroxycarbonate;Luperox(R) MC;Luperox(R) TAEC;O-(2-ethylhexyl) O,O-tert-pentyl peroxycarbonate;Peroxycarbonic acid OO-(1,1-dimethylpropyl)O-(2-ethylhexyl) ester;Luperox? TAEC | | CAS: | 70833-40-8 | | MF: | C14H28O4 | | MW: | 260.37 | | EINECS: | 274-919-2 | | Product Categories: | | | Mol File: | 70833-40-8.mol |  |
| | tert-Amylperoxy 2-ethylhexyl carbonate Chemical Properties |
| Boiling point | 290℃ | | density | 0.931 g/mL at 25 °C(lit.) | | vapor pressure | 93Pa at 20℃ | | refractive index | n20/D 1.432(lit.) | | Fp | 64 °C | | Water Solubility | 212.5-900000μg/L at 20℃ | | InChI | InChI=1S/C14H28O4/c1-6-9-10-12(7-2)11-16-13(15)17-18-14(4,5)8-3/h12H,6-11H2,1-5H3 | | InChIKey | HTCRKQHJUYBQTK-UHFFFAOYSA-N | | SMILES | C(OOC(C)(C)CC)(OCC(CC)CCCC)=O | | LogP | 2.9-5.8 at 20-25℃ | | EPA Substance Registry System | Carbonoperoxoic acid, OO-(1,1-dimethylpropyl) O-(2-ethylhexyl) ester (70833-40-8) |
| | tert-Amylperoxy 2-ethylhexyl carbonate Usage And Synthesis |
| Uses | Tert-Amyl Peroxy 2-Ethylhexyl Carbonate is a compound useful in organic synthesis. |
| | tert-Amylperoxy 2-ethylhexyl carbonate Preparation Products And Raw materials |
|