|
|
| | 5-(4-Nitrophenyl)thiophene-2-carboxylic& Basic information |
| Product Name: | 5-(4-Nitrophenyl)thiophene-2-carboxylic& | | Synonyms: | JR-8737, 5-(4-Nitrophenyl)thiophene-2-carboxylic acid, 97%;5-(4-NITROPHENYL)THIOPHENE-2-CARBOXYLIC ACID, 96%;5-(4-nitrophenyl)thiophene-2-carboxylic acid(SALTDATA: FREE);2-Thiophenecarboxylic acid, 5-(4-nitrophenyl)-;5-(4-nitrophenyl)thiophene-2-carboxylic acid;5-(4-Nitrophenyl)thiophene-2-carboxylic& | | CAS: | 80387-79-7 | | MF: | C11H7NO4S | | MW: | 249.24 | | EINECS: | | | Product Categories: | | | Mol File: | 80387-79-7.mol |  |
| | 5-(4-Nitrophenyl)thiophene-2-carboxylic& Chemical Properties |
| Melting point | 276-280 °C | | form | solid | | InChI | 1S/C11H7NO4S/c13-11(14)10-6-5-9(17-10)7-1-3-8(4-2-7)12(15)16/h1-6H,(H,13,14) | | InChIKey | KQLUSGVTGAPFDW-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(s1)-c2ccc(cc2)[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-(4-Nitrophenyl)thiophene-2-carboxylic& Usage And Synthesis |
| | 5-(4-Nitrophenyl)thiophene-2-carboxylic& Preparation Products And Raw materials |
|