| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
| Company Name: |
Novachemistry |
| Tel: |
44-20819178-90 02081917890 |
| Email: |
info@novachemistry.com |
2-Bromo-1 1 3 -trimethoxypropane 95 manufacturers
|
| | 2-Bromo-1 1 3 -trimethoxypropane 95 Basic information |
| Product Name: | 2-Bromo-1 1 3 -trimethoxypropane 95 | | Synonyms: | 2-bromo-1,1,3-trimethoxy-propan;2-bromo-3-methoxy-propionaldehyddimethylacetal;2-bromo-3-methoxypropionaldehydedimethylacetal;nsc6388;Propane, 2-bromo-1,1,3-trimethoxy-;Propionaldehyde, 2-bromo-3-methoxy-, dimethyl acetal;1-bromo-2-methoxypropionaldimethylacetal;2-Bromo-1 1 3 -trimethoxypropane 95 | | CAS: | 759-97-7 | | MF: | C6H13BrO3 | | MW: | 213.07 | | EINECS: | 212-074-3 | | Product Categories: | B;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 759-97-7.mol |  |
| | 2-Bromo-1 1 3 -trimethoxypropane 95 Chemical Properties |
| Boiling point | 54-55 °C/21 mmHg(lit.) | | density | 1.395 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.458(lit.) | | Fp | 76 °C | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H13BrO3/c1-8-4-5(7)6(9-2)10-3/h5-6H,4H2,1-3H3 | | InChIKey | GAFSXURUCDQGFB-UHFFFAOYSA-N | | SMILES | C(OC)(OC)C(Br)COC | | EPA Substance Registry System | Propane, 2-bromo-1,1,3-trimethoxy- (759-97-7) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26-36 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 2 | | RTECS | TX4185000 | | TSCA | TSCA listed |
| | 2-Bromo-1 1 3 -trimethoxypropane 95 Usage And Synthesis |
| Uses | 2-Bromo-1,1,3-trimethoxypropane is a stain/dye. Dyes and metabolites. |
| | 2-Bromo-1 1 3 -trimethoxypropane 95 Preparation Products And Raw materials |
|