|
|
| | tert-Butyl(4-iodobutoxy)dimethylsilane Basic information |
| | tert-Butyl(4-iodobutoxy)dimethylsilane Chemical Properties |
| Boiling point | 75 °C/0.5 mmHg (lit.) | | density | 1.214 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.48(lit.) | | Fp | >230 °F | | storage temp. | RT, protect from light | | Specific Gravity | 1.214 | | Appearance | Yellow to orange Liquid | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C10H23IOSi/c1-10(2,3)13(4,5)12-9-7-6-8-11/h6-9H2,1-5H3 | | InChIKey | INGJYKISFRSCQV-UHFFFAOYSA-N | | SMILES | [Si](C(C)(C)C)(OCCCCI)(C)C |
| WGK Germany | 3 | | TSCA | No | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids |
| | tert-Butyl(4-iodobutoxy)dimethylsilane Usage And Synthesis |
| Uses | tert-Butyl(4-iodobutoxy)dimethylsilane may be used as a reagent in the multi-step synthesis of spermine synthon and decanucleotide-spermine conjugates. | | General Description | tert-Butyl(4-iodobutoxy)dimethylsilane is an iodoorganosilane that can be synthesized from tert-butyl(chloro)dimethylsilane. |
| | tert-Butyl(4-iodobutoxy)dimethylsilane Preparation Products And Raw materials |
|