| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1-Adamantylphosphaethyne
CAS:101055-70-3
Purity:>=97.0% (GC/CH) Package:500MG Remarks:44478-500MG-F
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 18068836627 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:1-ADAMANTYLPHOSPHAETHYNE
CAS:101055-70-3
Purity:95+% Package:1g;5g;10g
|
|
| | 1-ADAMANTYLPHOSPHAETHYNE Basic information |
| | 1-ADAMANTYLPHOSPHAETHYNE Chemical Properties |
| Melting point | 69-72 °C | | storage temp. | -20°C | | form | solid | | InChI | 1S/C11H15P/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-6H2/t8-,9+,10-,11- | | InChIKey | PEMKIUPAYNEFGZ-BIBSGERRSA-N | | SMILES | P#CC12C[C@@H]3C[C@@H](C[C@@H](C3)C1)C2 | | CAS DataBase Reference | 101055-70-3 |
| WGK Germany | 3 | | F | 10-23 | | Storage Class | 11 - Combustible Solids |
| | 1-ADAMANTYLPHOSPHAETHYNE Usage And Synthesis |
| Uses | 1-Adamantylphosphaethyne is a reagent used in Organic synthesis. It is also used in the study of the vibrational spectra of 1-adamantylphosphaethyne in liquid and solid phases. |
| | 1-ADAMANTYLPHOSPHAETHYNE Preparation Products And Raw materials |
|