|
|
| | Tetrakis(triethanolaminato)zirconium(IV) Basic information |
| Product Name: | Tetrakis(triethanolaminato)zirconium(IV) | | Synonyms: | TYZOR(R) TEAZ organic zirconate;tetrakis[[2,2',2''-nitrilotris[ethanolato]](1-)-N,O]zirconium;Zirconium, tetrakis2-bis(2-hydroxyethyl)amino-.kappa.Nethanolato-.kappa.O-;Tetrakis(triethanolaminato)zirconium;Tetrakis(triethanloaMino)zirconiuM(IV);ZIRCONIUM TETRAKIS(TRIETHANOLAMINE);Zirconium,tetrakis[2-[bis(2-hydroxyethyl)amino-kN]ethanolato-kO]-;tetrakis[[2,2',2''-nitrilotris[ethanolato]](1-)-N,O]zirconiu... | | CAS: | 101033-44-7 | | MF: | C24H56N4O12Zr | | MW: | 683.95 | | EINECS: | 309-811-7 | | Product Categories: | | | Mol File: | 101033-44-7.mol |  |
| | Tetrakis(triethanolaminato)zirconium(IV) Chemical Properties |
| Boiling point | 335.4℃[at 101 325 Pa] | | density | 1.43 g/mL at 25 °C(lit.) | | vapor pressure | 1.33Pa at 20℃ | | refractive index | n20/D 1.525(lit.) | | Fp | 190 °F | | Water Solubility | 1000g/L at 25℃ | | InChI | InChI=1S/4C6H14NO3.Zr/c4*8-4-1-7(2-5-9)3-6-10;/h4*8-9H,1-6H2;/q4*-1;+4 | | InChIKey | ZHYKLLIOAFYKQR-UHFFFAOYSA-N | | SMILES | C(N1(CC[O-][Zr+4]2341([O-]CCN2(CCO)CCO)([O-]CCN3(CCO)CCO)[O-]CCN4(CCO)CCO)CCO)CO | | LogP | -1.59 at 20℃ | | EPA Substance Registry System | Zirconium, tetrakis[2-[bis(2-hydroxyethyl)amino-.kappa.N]ethanolato-.kappa.O]- (101033-44-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed |
| | Tetrakis(triethanolaminato)zirconium(IV) Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | Tetrakis(triethanolaminato)zirconium(IV) Preparation Products And Raw materials |
|