| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
PAPP manufacturers
- LY 165163
-
- $2500.00
-
2026-05-11
- CAS:1814-64-8
- Purity:
- Supply Ability: 10g
|
| Product Name: | PAPP | | Synonyms: | PAPP (LY-165,163) SELECTIVE 5-HT1A SERO;PAPP, p-Aminophenethyl-m-trifluoromethylphenyl piperazine, 4-[2-[4-[3-(Trifluoromethyl)phenyl]-1-piperazinyl]ethyl]benzeneamine;4-[2-[4-[3-(Trifluoromethyl)phenyl]-1-piperazinyl]ethyl]benzenamine;1-(2-(4-Aminophenyl)ethyl)-4-(3-trifluoromethylphenyl)piperazine;Benzenamine, 4-(2-(4-(3-(trifluoromethyl)phenyl)-1-piperazinyl)ethyl)-;p-Nh2-pe-tfmpp;LY 165;LY165 | | CAS: | 1814-64-8 | | MF: | C19H22F3N3 | | MW: | 349.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1814-64-8.mol |  |
| Melting point | 83-85 °C | | Boiling point | 464.1±45.0 °C(Predicted) | | density | 1.218±0.06 g/cm3(Predicted) | | solubility | 0.1 M HCl: slightly soluble | | form | solid | | pka | 7.85±0.10(Predicted) | | color | off-white | | InChI | 1S/C19H22F3N3/c20-19(21,22)16-2-1-3-18(14-16)25-12-10-24(11-13-25)9-8-15-4-6-17(23)7-5-15/h1-7,14H,8-13,23H2 | | InChIKey | GAAKALASJNGQKD-UHFFFAOYSA-N | | SMILES | Nc1ccc(CCN2CCN(CC2)c3cccc(c3)C(F)(F)F)cc1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| Uses | LY-165,163 is a selective 5-HT1A and 5-HT1D serotonin receptor antagonist. | | Definition | ChEBI: LY-165163 is a N-arylpiperazine that is piperazine susbtituted by 2-(4-aminophenyl)ethyl and 3-(trifluoromethyl)phenyl groups at positions 1 and 4, respectively. It is a selective 5-HT1A serotonin receptor agonist and 5-HT1D serotonin receptor antagonist. It has a role as a geroprotector and a serotonergic agonist. It is a N-arylpiperazine, a N-alkylpiperazine, a member of (trifluoromethyl)benzenes, a substituted aniline and a primary arylamine. It is functionally related to a 1-(3-(trifluoromethyl)phenyl)piperazine. | | Biological Activity | Selective 5-HT1A serotonin receptor agonist and 5-HT1D serotonin receptor antagonist. |
| | PAPP Preparation Products And Raw materials |
|