| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | DL-4-Chlorophenylalanine methyl ester hydrochloride Basic information |
| | DL-4-Chlorophenylalanine methyl ester hydrochloride Chemical Properties |
| Melting point | 186-189 °C(lit.) | | storage temp. | -20°C | | solubility | Soluble to 100 mM in water and to 100 mM in DMSO | | form | Solid | | color | White to off-white | | InChI | 1S/C10H12ClNO2.ClH/c1-14-10(13)9(12)6-7-2-4-8(11)5-3-7;/h2-5,9H,6,12H2,1H3;1H | | InChIKey | GCBCWTWQAFLKJG-UHFFFAOYSA-N | | SMILES | Cl.COC(=O)C(N)Cc1ccc(Cl)cc1 | | CAS DataBase Reference | 14173-40-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | AY4452100 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | DL-4-Chlorophenylalanine methyl ester hydrochloride Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | 4-Chloro-DL-phenylalanine methyl ester hydrochloride has been used to induce 5-hydroxytryptamine (5-HT) depletion in rats. | | General Description | 4-Chloro-DL-phenylalanine methyl ester hydrochloride stimulates glucose intolerance in pregnant mice. Studies have shown that 4-Chloro-DL-phenylalanine methyl ester hydrochloride is associated with cognitive defects in rodents. | | Biochem/physiol Actions | Tryptophan hydroxylase inhibitor. Crosses blood brain barrier better than pchlorophenylalanine. | | storage | Store at -20°C |
| | DL-4-Chlorophenylalanine methyl ester hydrochloride Preparation Products And Raw materials |
|