| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 4H-(1)-benzopyrano(4 3-b)thiophe& Basic information |
| Product Name: | Methyl 4H-(1)-benzopyrano(4 3-b)thiophe& | | Synonyms: | JR-8727, Methyl 4H-(1)-benzopyrano-[4,3-b]thiophene-2-carboxylate, 97%;Methyl 4H-[1]-benzopyrano[4,3-b]thiophene-2-carboxylate;Methyl 4H-[1]-benzopyrano[4,3-b]thiophene-2-carboxylate 97%;4H-Thieno[3,2-c][1]benzopyran-2-carboxylic acid, methyl ester;Methyl 4H<;Methyl 4H-[1]-benzopyrano[4,3-b]thiophene-2-carboxylate;Methyl 4H-thieno[3,2-c]chroMene-2-carboxylate;Methyl 4H-(1)-benzopyrano(4 3-b)thiophe& | | CAS: | 126522-01-8 | | MF: | C13H10O3S | | MW: | 246.28 | | EINECS: | | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Thiophenes | | Mol File: | 126522-01-8.mol |  |
| | Methyl 4H-(1)-benzopyrano(4 3-b)thiophe& Chemical Properties |
| Boiling point | 435.6±40.0 °C(Predicted) | | density | 1.334±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C13H10O3S/c1-15-13(14)11-6-8-7-16-10-5-3-2-4-9(10)12(8)17-11/h2-6H,7H2,1H3 | | InChIKey | SSWWLCIIZQNEAE-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc2COc3ccccc3-c2s1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Methyl 4H-(1)-benzopyrano(4 3-b)thiophe& Usage And Synthesis |
| | Methyl 4H-(1)-benzopyrano(4 3-b)thiophe& Preparation Products And Raw materials |
|