|
|
| | 3-Carbomethoxy-1 2 3 4-tetrahydroisoqui& Basic information |
| | 3-Carbomethoxy-1 2 3 4-tetrahydroisoqui& Chemical Properties |
| Melting point | 220-224 °C(lit.) | | Boiling point | 481.2±45.0 °C(Predicted) | | density | 1.345±0.06 g/cm3(Predicted) | | form | Crystalline Powder | | pka | 10.48±0.20(Predicted) | | color | White to beige | | InChI | 1S/C11H9NO4/c1-16-11(15)8-9(13)6-4-2-3-5-7(6)10(14)12-8/h2-5,8H,1H3,(H,12,14) | | InChIKey | FQCQGFASLAKUTO-UHFFFAOYSA-N | | SMILES | COC(=O)C1NC(=O)c2ccccc2C1=O |
| WGK Germany | 3 | | HS Code | 29334990 | | Storage Class | 11 - Combustible Solids |
| | 3-Carbomethoxy-1 2 3 4-tetrahydroisoqui& Usage And Synthesis |
| | 3-Carbomethoxy-1 2 3 4-tetrahydroisoqui& Preparation Products And Raw materials |
|