| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-[2-(Trifluoromethyl)phenyl]-2-furoic Basic information |
| | 5-[2-(Trifluoromethyl)phenyl]-2-furoic Chemical Properties |
| Melting point | 163-167 °C(lit.) | | Boiling point | 372.9±42.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | pka | 2.98±0.10(Predicted) | | form | solid | | InChI | 1S/C12H7F3O3/c13-12(14,15)8-4-2-1-3-7(8)9-5-6-10(18-9)11(16)17/h1-6H,(H,16,17) | | InChIKey | IJPNRBZMRINMMR-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(o1)-c2ccccc2C(F)(F)F |
| Hazard Codes | T | | Risk Statements | 25-36/37/38-43 | | Safety Statements | 26-36/37 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 5-[2-(Trifluoromethyl)phenyl]-2-furoic Usage And Synthesis |
| Uses | 5-[2-(Trifluoromethyl)phenyl]-2-furoic Acid is a chemical reagent used in the preparation of novel TRPV1 antagonists. Also used in the preparation of potent inhibitors of FeII and MnII E, coli Methionine Aminopeptidase as antibacterial agents. |
| | 5-[2-(Trifluoromethyl)phenyl]-2-furoic Preparation Products And Raw materials |
|