| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Fensulfothion-oxon
CAS:6552-21-2
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
ShangHai Anpel Co, Ltd.
|
| Tel: |
18502138905 |
| Email: |
shanpel@anpel.com.cn |
| Products Intro: |
Product Name:Fensulfothion-oxon
CAS:6552-21-2
Purity:99.3% Package:25mg Remarks:CDAA-412153-25mg
|
|
| | FENSULFOTHION-OXON Basic information |
| | FENSULFOTHION-OXON Chemical Properties |
| storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Yellow | | Stability: | Hygroscopic, Moisture Sensitive | | Major Application | agriculture
environmental | | InChI | 1S/C11H17O5PS/c1-4-14-17(12,15-5-2)16-10-6-8-11(9-7-10)18(3)13/h6-9H,4-5H2,1-3H3 | | InChIKey | GNTVZNNILZKEIB-UHFFFAOYSA-N | | SMILES | CS(C1=CC=C(OP(OCC)(OCC)=O)C=C1)=O |
| RIDADR | 2783 | | WGK Germany | WGK 3 | | HazardClass | 6.1(a) | | PackingGroup | I | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | FENSULFOTHION-OXON Usage And Synthesis |
| Uses | Fensulfothion Oxon is a metabolite of the insecticide fensulfonthion (F265490), an inhibitor of cholinesterase activity. |
| | FENSULFOTHION-OXON Preparation Products And Raw materials |
|