|
|
| | Benzenamine, 3-methoxy-2,6-dimethyl- Basic information |
| Product Name: | Benzenamine, 3-methoxy-2,6-dimethyl- | | Synonyms: | Benzenamine, 3-methoxy-2,6-dimethyl-;3-Methoxy-2,6-dimethylbenzenamine;3-Methoxy-2,6-dimethyl-phenylamine;3-methoxy-2,6-dimethylbenzeneamine;3-methoxy-2,6-dimethylaniline | | CAS: | 95645-00-4 | | MF: | C9H13NO | | MW: | 151.21 | | EINECS: | | | Product Categories: | | | Mol File: | 95645-00-4.mol |  |
| | Benzenamine, 3-methoxy-2,6-dimethyl- Chemical Properties |
| Boiling point | 260.1±35.0 °C(Predicted) | | density | 1.019±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 3.88±0.10(Predicted) | | Appearance | Light yellow to brown Solid-liquid mixture | | InChI | InChI=1S/C9H13NO/c1-6-4-5-8(11-3)7(2)9(6)10/h4-5H,10H2,1-3H3 | | InChIKey | DBRPRHMYNICNTR-UHFFFAOYSA-N | | SMILES | C1(N)=C(C)C=CC(OC)=C1C |
| | Benzenamine, 3-methoxy-2,6-dimethyl- Usage And Synthesis |
| | Benzenamine, 3-methoxy-2,6-dimethyl- Preparation Products And Raw materials |
|