| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Methoxy-2-methylaniline Basic information |
| | 3-Methoxy-2-methylaniline Chemical Properties |
| Melting point | 27-28°C | | Boiling point | 243.4±20.0 °C(Predicted) | | density | 1.08 | | refractive index | 1.5730-1.5770 | | Fp | >110℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Oil | | pka | 4.03±0.10(Predicted) | | color | Brown to Dark Brown | | InChI | InChI=1S/C8H11NO/c1-6-7(9)4-3-5-8(6)10-2/h3-5H,9H2,1-2H3 | | InChIKey | OPXLVWLFDKRYRB-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(OC)=C1C | | CAS DataBase Reference | 19500-02-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | RIDADR | 2810 | | WGK Germany | 1 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2921490090 |
| | 3-Methoxy-2-methylaniline Usage And Synthesis |
| Chemical Properties | Brown Oil | | Uses | 3-Methoxy-2-methylaniline is a aniline derivative used in the preparation of indoles and indazoles with potential neurochemical activity, as well as in the preparation of quinoline based antiviral agents. | | Synthesis | The general procedure for the synthesis of 3-methoxy-2-methylaniline from 2-methyl-3-nitroanisole is as follows (reference Example 42):
1. 9.98 g of a suspension of 5% palladium-carbon (wet) in 100 mL of ethanol was added to a solution of 30.7 g (184 mmol) of 2-methyl-3-nitroanisole in 300 mL of ethanol.
2. The reaction mixture was stirred at room temperature and under hydrogen atmosphere for 3 hours.
3. Upon completion of the reaction, the reaction solution was filtered through diatomaceous earth.
4. The filtrate was concentrated under vacuum to give 25.5 g of 3-methoxy-2-methylaniline as a light purple oil (Yield: quantitative).
Rf value: 0.38 (hexane: ethyl acetate = 2:1, v/v).
Mass spectrum (EI, m/z): 137 (M+).
1H-NMR spectrum (CDCl3, δ ppm): 2.04-2.05 (m, 3H), 3.60 (brs, 2H), 3.80 (s, 3H), 6.33-6.37 (m, 2H), 6.94-7.01 (m, 1H). | | References | [1] Patent: EP1679308, 2006, A1. Location in patent: Page/Page column 56
[2] Patent: US2009/12123, 2009, A1. Location in patent: Page/Page column 14-15
[3] Patent: WO2004/103996, 2004, A1. Location in patent: Page 38-39
[4] Patent: WO2006/7700, 2006, A1. Location in patent: Page/Page column 61
[5] Patent: US2006/19905, 2006, A1. Location in patent: Page/Page column 24 |
| | 3-Methoxy-2-methylaniline Preparation Products And Raw materials |
|