| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| Product Name: | TFCA | | Synonyms: | TFCA;2-Propenamide, 3-(3,4-dimethoxyphenyl)-N-[4-(trifluoromethyl)phenyl]-;3-(3,4-Dimethoxyphenyl)-N-[4-(trifluoromethyl)phenyl]-2-propenamide | | CAS: | 895700-18-2 | | MF: | C18H16F3NO3 | | MW: | 351.32 | | EINECS: | | | Product Categories: | | | Mol File: | 895700-18-2.mol |  |
| Boiling point | 497.077±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.287±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | room temp | | solubility | DMSO: 25mg/mL, clear | | form | powder | | pka | 13.008±0.70(predicted) | | color | white to beige | | InChI | 1S/C18H16F3NO3/c1-24-15-9-3-12(11-16(15)25-2)4-10-17(23)22-14-7-5-13(6-8-14)18(19,20)21/h3-11H,1-2H3,(H,22,23)/b10-4+ | | InChIKey | KFWWXJZNIMFFRO-ONNFQVAWSA-N | | SMILES | O=C(NC1=CC=C(C(F)(F)F)C=C1)/C=C/C2=CC=C(OC)C(OC)=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Biological Activity | TFCA is a Liver X receptor α (LXRα) antagonist th at reduces lipid accumulation and fatty liver in mice. Apparently TFCA binds to the LXR ligand binding domain and induces interaction with NCoR corepressor. |
| | TFCA Preparation Products And Raw materials |
|