| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
CAS:63909-10-4
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:1-(5-Ethyl-2-hydroxyphenyl)propan-1-one
CAS:63909-10-4
|
| Company Name: |
Heterocyclics Inc
|
| Tel: |
732-444-6336 |
| Email: |
info@heterocyclics.com |
| Products Intro: |
Product Name:JRH-01107, 1-(5-Ethyl-2-hydroxyphenyl)propan-1-one, 97%
CAS:63909-10-4
|
| Company Name: |
Carbocore, Inc.
|
| Tel: |
281 367 6833 |
| Email: |
sales@carbocore.com |
| Products Intro: |
|
| Company Name: |
MOLEKULA Ltd.
|
| Tel: |
+44 (0) 1747 831066 |
| Email: |
kevinbanks@molekula.com |
| Products Intro: |
|
|
| | 5'-ETHYL-2'-HYDROXYPROPIOPHENONE Basic information |
| | 5'-ETHYL-2'-HYDROXYPROPIOPHENONE Chemical Properties |
| form | solid | | InChI | 1S/C11H14O2/c1-3-8-5-6-11(13)9(7-8)10(12)4-2/h5-7,13H,3-4H2,1-2H3 | | InChIKey | OYDWDJIBKKHEJM-UHFFFAOYSA-N | | SMILES | CCC1=CC(C(CC)=O)=C(O)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | 5'-ETHYL-2'-HYDROXYPROPIOPHENONE Usage And Synthesis |
| Preparation | Preparation by Fries rearrangement of 4-ethylphenyl propionate with aluminium chloride at 100° for 2 h (70%) or at 170° for 1–2 h (80–96%). |
| | 5'-ETHYL-2'-HYDROXYPROPIOPHENONE Preparation Products And Raw materials |
|