| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Formyl-6-isopropylchromone Basic information |
| Product Name: | 3-Formyl-6-isopropylchromone | | Synonyms: | AM-3;3-FORMYL-6-ISOPROPYLCHROMONE 99%;3-Cyano-4-methony-2-(1H)-pyridinoneC7H6N2O2;3-FORMYL-6-ISOPROPYLCHROMONE;4H-1-BENZOPYRAN-6-ISOPROPYL-4-OXO-3-CARBOXALDEHYDE;6-ISOPROPYL-4-OXO-4H-1-BENZOPYRAN-3-CARBOXALDEHYDE;6-ISOPROPYL-4-OXO-4H-CHROMENE-3-CARBALDEHYDE;6-Isopropyl-4-oxo-4H-1-benzopuran-3-carboxaldehyde | | CAS: | 49619-58-1 | | MF: | C13H12O3 | | MW: | 216.23 | | EINECS: | 624-175-3 | | Product Categories: | Miscellaneous | | Mol File: | 49619-58-1.mol |  |
| | 3-Formyl-6-isopropylchromone Chemical Properties |
| Melting point | 98-100 °C(lit.) | | Boiling point | 339.8±42.0 °C(Predicted) | | density | 1.17 g/cm3 | | storage temp. | 2-8°C, stored under nitrogen | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C13H12O3/c1-8(2)9-3-4-12-11(5-9)13(15)10(6-14)7-16-12/h3-8H,1-2H3 | | InChIKey | FRRYMYQANNFABF-UHFFFAOYSA-N | | SMILES | C1OC2=CC=C(C(C)C)C=C2C(=O)C=1C=O | | CAS DataBase Reference | 49619-58-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2932.99.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Formyl-6-isopropylchromone Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 3-Formyl-6-isopropylchromone is the suitable reagent used in a study to investigate the multidrug resistance reversal by some 3- formylchromones in human colon cancer and mouse lymphoma cells transfected with the human MDR1 gene. | | General Description | 3-Formyl-6-isopropylchromone (6-Isopropyl-4-oxo-4H-1-benzopyran-3-carboxaldehyde, 6-Isopropyl-4-oxo-4H-chromene-3-carbaldehyde), a pyrazine (paradiazine) derivative, is a heterocyclic building block. It is a heterocyclic six-membered aromatic compound bearing nitrogen atoms at para positions.
Combustion calorimetric experiments have been conducted to evaluate the enthalpy of combustion of 3-formyl-6-isopropylchromone. Cytotoxic activity of 3-formyl-6-isopropylchromone against normal and tumor cells in vivo has been tested. |
| | 3-Formyl-6-isopropylchromone Preparation Products And Raw materials |
|